C27H36FN3O3 — CID 58588944
4-[4-[(6R,9aS)-2-(4-fluoro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]butanamide (PubChem CID 58588944) has the molecular formula C27H36FN3O3 and a molecular weight of 469.60 g/mol. Its IUPAC name is 4-[4-[(6R,9aS)-2-(4-fluoro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]butanamide.
| Compound Name | 4-[4-[(6R,9aS)-2-(4-fluoro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]butanamide |
|---|---|
| PubChem CID | 58588944 |
| Molecular Formula | C27H36FN3O3 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 4-[4-[(6R,9aS)-2-(4-fluoro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]butanamide |
| SMILES | COc1cc(N2CCN3[C@@H](CCC[C@@H]3c3ccc(OCCCC(N)=O)c(C)c3C)C2)ccc1F |
| InChI | InChI=1S/C27H36FN3O3/c1-18-19(2)25(34-15-5-8-27(29)32)12-10-22(18)24-7-4-6-21-17-30(13-14-31(21)24)20-9-11-23(28)26(16-20)33-3/h9-12,16,21,24H,4-8,13-15,17H2,1-3H3,(H2,29,32)/t21-,24+/m0/s1 |
| InChIKey | ZDTBFLWFMLSWQH-XUZZJYLKSA-N |
| XLogP | 4.51 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|