C30H37ClN4O2 — CID 143169316
N-[2-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]ethyl]pyridin-4-amine (PubChem CID 143169316) has the molecular formula C30H37ClN4O2 and a molecular weight of 521.11 g/mol. Its IUPAC name is N-[2-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]ethyl]pyridin-4-amine.
| Compound Name | N-[2-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 143169316 |
| Molecular Formula | C30H37ClN4O2 |
| Molecular Weight | 521.11 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | N-[2-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]ethyl]pyridin-4-amine |
| SMILES | COc1cc(N2CCN3C(CCC[C@@H]3c3ccc(OCCNc4ccncc4)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C30H37ClN4O2/c1-21-22(2)29(37-18-15-33-23-11-13-32-14-12-23)10-8-26(21)28-6-4-5-25-20-34(16-17-35(25)28)24-7-9-27(31)30(19-24)36-3/h7-14,19,25,28H,4-6,15-18,20H2,1-3H3,(H,32,33)/t25?,28-/m1/s1 |
| InChIKey | WPUAAQPPWZGENU-MPSNESSQSA-N |
| XLogP | 6.27 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.11 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|