C31H45ClN4O2 — CID 58589257
(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-6-[2,3-dimethyl-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 58589257) has the molecular formula C31H45ClN4O2 and a molecular weight of 541.18 g/mol. Its IUPAC name is (6R,9aS)-2-(4-chloro-3-methoxyphenyl)-6-[2,3-dimethyl-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (6R,9aS)-2-(4-chloro-3-methoxyphenyl)-6-[2,3-dimethyl-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 58589257 |
| Molecular Formula | C31H45ClN4O2 |
| Molecular Weight | 541.18 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | (6R,9aS)-2-(4-chloro-3-methoxyphenyl)-6-[2,3-dimethyl-4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | COc1cc(N2CCN3[C@@H](CCC[C@@H]3c3ccc(OCCCN4CCN(C)CC4)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C31H45ClN4O2/c1-23-24(2)30(38-20-6-13-34-16-14-33(3)15-17-34)12-10-27(23)29-8-5-7-26-22-35(18-19-36(26)29)25-9-11-28(32)31(21-25)37-4/h9-12,21,26,29H,5-8,13-20,22H2,1-4H3/t26-,29+/m0/s1 |
| InChIKey | KMZVLYLANROFNJ-LITSAYRRSA-N |
| XLogP | 5.40 |
| TPSA | 31.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.18 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|