C29H40ClN3O3 — CID 143169575
1-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]-3-(cyclopropylamino)propan-2-ol (PubChem CID 143169575) has the molecular formula C29H40ClN3O3 and a molecular weight of 514.11 g/mol. Its IUPAC name is 1-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]-3-(cyclopropylamino)propan-2-ol.
| Compound Name | 1-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]-3-(cyclopropylamino)propan-2-ol |
|---|---|
| PubChem CID | 143169575 |
| Molecular Formula | C29H40ClN3O3 |
| Molecular Weight | 514.11 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 1-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]-3-(cyclopropylamino)propan-2-ol |
| SMILES | COc1cc(N2CCN3C(CCC[C@@H]3c3ccc(OCC(O)CNC4CC4)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C29H40ClN3O3/c1-19-20(2)28(36-18-24(34)16-31-21-7-8-21)12-10-25(19)27-6-4-5-23-17-32(13-14-33(23)27)22-9-11-26(30)29(15-22)35-3/h9-12,15,21,23-24,27,31,34H,4-8,13-14,16-18H2,1-3H3/t23?,24?,27-/m1/s1 |
| InChIKey | YJFJTATZFUMRAQ-PUUKEUDRSA-N |
| XLogP | 4.87 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.11 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |