C26H35ClN2O2 — CID 143169321
(6R)-2-(4-chloro-3-methoxyphenyl)-6-(2,3-dimethyl-4-propan-2-yloxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 143169321) has the molecular formula C26H35ClN2O2 and a molecular weight of 443.03 g/mol. Its IUPAC name is (6R)-2-(4-chloro-3-methoxyphenyl)-6-(2,3-dimethyl-4-propan-2-yloxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-(2,3-dimethyl-4-propan-2-yloxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 143169321 |
| Molecular Formula | C26H35ClN2O2 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-(2,3-dimethyl-4-propan-2-yloxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | COc1cc(N2CCN3C(CCC[C@@H]3c3ccc(OC(C)C)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C26H35ClN2O2/c1-17(2)31-25-12-10-22(18(3)19(25)4)24-8-6-7-21-16-28(13-14-29(21)24)20-9-11-23(27)26(15-20)30-5/h9-12,15,17,21,24H,6-8,13-14,16H2,1-5H3/t21?,24-/m1/s1 |
| InChIKey | HTNOTBLNQSSYEU-MQNHUJCZSA-N |
| XLogP | 6.17 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |