C29H37ClN4O4 — CID 58588850
4-[2-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]acetyl]piperazin-2-one (PubChem CID 58588850) has the molecular formula C29H37ClN4O4 and a molecular weight of 541.09 g/mol. Its IUPAC name is 4-[2-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]acetyl]piperazin-2-one.
| Compound Name | 4-[2-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 58588850 |
| Molecular Formula | C29H37ClN4O4 |
| Molecular Weight | 541.09 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 4-[2-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]acetyl]piperazin-2-one |
| SMILES | COc1cc(N2CCN3[C@@H](CCC[C@@H]3c3ccc(OCC(=O)N4CCNC(=O)C4)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C29H37ClN4O4/c1-19-20(2)26(38-18-29(36)33-12-11-31-28(35)17-33)10-8-23(19)25-6-4-5-22-16-32(13-14-34(22)25)21-7-9-24(30)27(15-21)37-3/h7-10,15,22,25H,4-6,11-14,16-18H2,1-3H3,(H,31,35)/t22-,25+/m0/s1 |
| InChIKey | GZAPDFIMZOQENS-WIOPSUGQSA-N |
| XLogP | 3.72 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.09 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |