C30H40ClN3O3 — CID 58588926
1-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]pyrrolidin-2-one (PubChem CID 58588926) has the molecular formula C30H40ClN3O3 and a molecular weight of 526.12 g/mol. Its IUPAC name is 1-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 58588926 |
| Molecular Formula | C30H40ClN3O3 |
| Molecular Weight | 526.12 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | 1-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]pyrrolidin-2-one |
| SMILES | COc1cc(N2CCN3[C@@H](CCC[C@@H]3c3ccc(OCCCN4CCCC4=O)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C30H40ClN3O3/c1-21-22(2)28(37-18-6-15-32-14-5-9-30(32)35)13-11-25(21)27-8-4-7-24-20-33(16-17-34(24)27)23-10-12-26(31)29(19-23)36-3/h10-13,19,24,27H,4-9,14-18,20H2,1-3H3/t24-,27+/m0/s1 |
| InChIKey | UDWLHFNVUAQQKU-RPLLCQBOSA-N |
| XLogP | 5.77 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.12 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|