C31H44ClN3O3 — CID 58588911
4-[4-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]butyl]morpholine (PubChem CID 58588911) has the molecular formula C31H44ClN3O3 and a molecular weight of 542.16 g/mol. Its IUPAC name is 4-[4-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]butyl]morpholine.
| Compound Name | 4-[4-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]butyl]morpholine |
|---|---|
| PubChem CID | 58588911 |
| Molecular Formula | C31H44ClN3O3 |
| Molecular Weight | 542.16 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 4-[4-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]butyl]morpholine |
| SMILES | COc1cc(N2CCN3[C@@H](CCC[C@@H]3c3ccc(OCCCCN4CCOCC4)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C31H44ClN3O3/c1-23-24(2)30(38-18-5-4-13-33-16-19-37-20-17-33)12-10-27(23)29-8-6-7-26-22-34(14-15-35(26)29)25-9-11-28(32)31(21-25)36-3/h9-12,21,26,29H,4-8,13-20,22H2,1-3H3/t26-,29+/m0/s1 |
| InChIKey | UVMOOTXVPOIDCT-LITSAYRRSA-N |
| XLogP | 5.87 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.16 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|