C29H41ClN4O3 — CID 143169205
2-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]-N-[2-(dimethylamino)ethyl]acetamide (PubChem CID 143169205) has the molecular formula C29H41ClN4O3 and a molecular weight of 529.13 g/mol. Its IUPAC name is 2-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]-N-[2-(dimethylamino)ethyl]acetamide.
| Compound Name | 2-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]-N-[2-(dimethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 143169205 |
| Molecular Formula | C29H41ClN4O3 |
| Molecular Weight | 529.13 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | 2-[4-[(6R)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]-N-[2-(dimethylamino)ethyl]acetamide |
| SMILES | COc1cc(N2CCN3C(CCC[C@@H]3c3ccc(OCC(=O)NCCN(C)C)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C29H41ClN4O3/c1-20-21(2)27(37-19-29(35)31-13-14-32(3)4)12-10-24(20)26-8-6-7-23-18-33(15-16-34(23)26)22-9-11-25(30)28(17-22)36-5/h9-12,17,23,26H,6-8,13-16,18-19H2,1-5H3,(H,31,35)/t23?,26-/m1/s1 |
| InChIKey | ZXRWKJKUNUXTTJ-ANWICMFUSA-N |
| XLogP | 4.44 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.13 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |