C23H29ClN2O2 — CID 58727377
(6R)-2-(4-chloro-3-methylphenyl)-6-(3,4-dimethoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 58727377) has the molecular formula C23H29ClN2O2 and a molecular weight of 400.95 g/mol. Its IUPAC name is (6R)-2-(4-chloro-3-methylphenyl)-6-(3,4-dimethoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (6R)-2-(4-chloro-3-methylphenyl)-6-(3,4-dimethoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 58727377 |
| Molecular Formula | C23H29ClN2O2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (6R)-2-(4-chloro-3-methylphenyl)-6-(3,4-dimethoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | COc1ccc([C@H]2CCCC3CN(c4ccc(Cl)c(C)c4)CCN32)cc1OC |
| InChI | InChI=1S/C23H29ClN2O2/c1-16-13-18(8-9-20(16)24)25-11-12-26-19(15-25)5-4-6-21(26)17-7-10-22(27-2)23(14-17)28-3/h7-10,13-14,19,21H,4-6,11-12,15H2,1-3H3/t19?,21-/m1/s1 |
| InChIKey | DTANIZQWLMBDOG-VGAJERRHSA-N |
| XLogP | 5.08 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |