C23H27ClN2O4 — CID 23395632
(6R)-2-(4-chloro-3-methoxyphenyl)-6-(3,4-dimethoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-one (PubChem CID 23395632) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is (6R)-2-(4-chloro-3-methoxyphenyl)-6-(3,4-dimethoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-one.
| Compound Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-(3,4-dimethoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-one |
|---|---|
| PubChem CID | 23395632 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-(3,4-dimethoxyphenyl)-3,4,6,7,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-8-one |
| SMILES | COc1cc(N2CCN3C(CC(=O)C[C@@H]3c3ccc(OC)c(OC)c3)C2)ccc1Cl |
| InChI | InChI=1S/C23H27ClN2O4/c1-28-21-7-4-15(10-23(21)30-3)20-13-18(27)11-17-14-25(8-9-26(17)20)16-5-6-19(24)22(12-16)29-2/h4-7,10,12,17,20H,8-9,11,13-14H2,1-3H3/t17?,20-/m1/s1 |
| InChIKey | ZAQHRSMSCIQDQJ-UUSAFJCLSA-N |
| XLogP | 3.96 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |