C14H20Cl2N2O — CID 143061845
(2S)-1-(2-chloroethyl)-4-(4-chloro-3-methoxyphenyl)-2-methylpiperazine (PubChem CID 143061845) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is (2S)-1-(2-chloroethyl)-4-(4-chloro-3-methoxyphenyl)-2-methylpiperazine.
| Compound Name | (2S)-1-(2-chloroethyl)-4-(4-chloro-3-methoxyphenyl)-2-methylpiperazine |
|---|---|
| PubChem CID | 143061845 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (2S)-1-(2-chloroethyl)-4-(4-chloro-3-methoxyphenyl)-2-methylpiperazine |
| SMILES | COc1cc(N2CCN(CCCl)[C@@H](C)C2)ccc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O/c1-11-10-18(8-7-17(11)6-5-15)12-3-4-13(16)14(9-12)19-2/h3-4,9,11H,5-8,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | GCYDXVISTRRCHE-NSHDSACASA-N |
| XLogP | 3.10 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|