C14H23N3O — CID 63677784
4-(4-ethyl-3-methylpiperazin-1-yl)-2-methoxyaniline (PubChem CID 63677784) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 4-(4-ethyl-3-methylpiperazin-1-yl)-2-methoxyaniline.
| Compound Name | 4-(4-ethyl-3-methylpiperazin-1-yl)-2-methoxyaniline |
|---|---|
| PubChem CID | 63677784 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 4-(4-ethyl-3-methylpiperazin-1-yl)-2-methoxyaniline |
| SMILES | CCN1CCN(c2ccc(N)c(OC)c2)CC1C |
| InChI | InChI=1S/C14H23N3O/c1-4-16-7-8-17(10-11(16)2)12-5-6-13(15)14(9-12)18-3/h5-6,9,11H,4,7-8,10,15H2,1-3H3 |
| InChIKey | MAACZZIHPWENIO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|