C12H20N4 — CID 63608912
5-(4-ethyl-3-methylpiperazin-1-yl)pyridin-2-amine (PubChem CID 63608912) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-(4-ethyl-3-methylpiperazin-1-yl)pyridin-2-amine.
| Compound Name | 5-(4-ethyl-3-methylpiperazin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 63608912 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 5-(4-ethyl-3-methylpiperazin-1-yl)pyridin-2-amine |
| SMILES | CCN1CCN(c2ccc(N)nc2)CC1C |
| InChI | InChI=1S/C12H20N4/c1-3-15-6-7-16(9-10(15)2)11-4-5-12(13)14-8-11/h4-5,8,10H,3,6-7,9H2,1-2H3,(H2,13,14) |
| InChIKey | NTUQNEHWOAISCQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |