C8H11N3O — CID 58043812
1-(6-amino-3-pyridinyl)azetidin-3-ol (PubChem CID 58043812) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 1-(6-amino-3-pyridinyl)azetidin-3-ol.
| Compound Name | 1-(6-amino-3-pyridinyl)azetidin-3-ol |
|---|---|
| PubChem CID | 58043812 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 1-(6-amino-3-pyridinyl)azetidin-3-ol |
| SMILES | Nc1ccc(N2CC(O)C2)cn1 |
| InChI | InChI=1S/C8H11N3O/c9-8-2-1-6(3-10-8)11-4-7(12)5-11/h1-3,7,12H,4-5H2,(H2,9,10) |
| InChIKey | APRJBQHMWFCVLV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |