C10H16N4 — CID 141318309
5-[(3R)-3-methylpiperazin-1-yl]pyridin-2-amine (PubChem CID 141318309) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 5-[(3R)-3-methylpiperazin-1-yl]pyridin-2-amine.
| Compound Name | 5-[(3R)-3-methylpiperazin-1-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 141318309 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 5-[(3R)-3-methylpiperazin-1-yl]pyridin-2-amine |
| SMILES | C[C@@H]1CN(c2ccc(N)nc2)CCN1 |
| InChI | InChI=1S/C10H16N4/c1-8-7-14(5-4-12-8)9-2-3-10(11)13-6-9/h2-3,6,8,12H,4-5,7H2,1H3,(H2,11,13)/t8-/m1/s1 |
| InChIKey | GLKGSJVNUCTAFW-MRVPVSSYSA-N |
| XLogP | 0.46 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |