C11H14N4 — CID 104977608
5-[(3S)-3-methylpiperazin-1-yl]pyridine-2-carbonitrile (PubChem CID 104977608) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-[(3S)-3-methylpiperazin-1-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[(3S)-3-methylpiperazin-1-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 104977608 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 5-[(3S)-3-methylpiperazin-1-yl]pyridine-2-carbonitrile |
| SMILES | C[C@H]1CN(c2ccc(C#N)nc2)CCN1 |
| InChI | InChI=1S/C11H14N4/c1-9-8-15(5-4-13-9)11-3-2-10(6-12)14-7-11/h2-3,7,9,13H,4-5,8H2,1H3/t9-/m0/s1 |
| InChIKey | WMXLYOHFDKCFFZ-VIFPVBQESA-N |
| XLogP | 0.75 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |