C28H39ClN2O2 — CID 143169531
(6R)-2-(4-chloro-3-methoxyphenyl)-6-[2,3-dimethyl-4-(3-methylbutoxy)phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 143169531) has the molecular formula C28H39ClN2O2 and a molecular weight of 471.09 g/mol. Its IUPAC name is (6R)-2-(4-chloro-3-methoxyphenyl)-6-[2,3-dimethyl-4-(3-methylbutoxy)phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-[2,3-dimethyl-4-(3-methylbutoxy)phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 143169531 |
| Molecular Formula | C28H39ClN2O2 |
| Molecular Weight | 471.09 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-[2,3-dimethyl-4-(3-methylbutoxy)phenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | COc1cc(N2CCN3C(CCC[C@@H]3c3ccc(OCCC(C)C)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C28H39ClN2O2/c1-19(2)13-16-33-27-12-10-24(20(3)21(27)4)26-8-6-7-23-18-30(14-15-31(23)26)22-9-11-25(29)28(17-22)32-5/h9-12,17,19,23,26H,6-8,13-16,18H2,1-5H3/t23?,26-/m1/s1 |
| InChIKey | VLUKIEUGRIDKPC-ANWICMFUSA-N |
| XLogP | 6.81 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.09 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |