C30H41ClN4O3 — CID 58589311
4-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]piperazin-2-one (PubChem CID 58589311) has the molecular formula C30H41ClN4O3 and a molecular weight of 541.14 g/mol. Its IUPAC name is 4-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]piperazin-2-one.
| Compound Name | 4-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]piperazin-2-one |
|---|---|
| PubChem CID | 58589311 |
| Molecular Formula | C30H41ClN4O3 |
| Molecular Weight | 541.14 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 4-[3-[4-[(6R,9aS)-2-(4-chloro-3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-yl]-2,3-dimethylphenoxy]propyl]piperazin-2-one |
| SMILES | COc1cc(N2CCN3[C@@H](CCC[C@@H]3c3ccc(OCCCN4CCNC(=O)C4)c(C)c3C)C2)ccc1Cl |
| InChI | InChI=1S/C30H41ClN4O3/c1-21-22(2)28(38-17-5-13-33-14-12-32-30(36)20-33)11-9-25(21)27-7-4-6-24-19-34(15-16-35(24)27)23-8-10-26(31)29(18-23)37-3/h8-11,18,24,27H,4-7,12-17,19-20H2,1-3H3,(H,32,36)/t24-,27+/m0/s1 |
| InChIKey | CREZBTXQOIYVJX-RPLLCQBOSA-N |
| XLogP | 4.58 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.14 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|