C22H27ClN2O3 — CID 58727359
(6R)-2-(4-chloro-3-methoxyphenyl)-6-(3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-8-ol (PubChem CID 58727359) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is (6R)-2-(4-chloro-3-methoxyphenyl)-6-(3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-8-ol.
| Compound Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-(3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-8-ol |
|---|---|
| PubChem CID | 58727359 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (6R)-2-(4-chloro-3-methoxyphenyl)-6-(3-methoxyphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-8-ol |
| SMILES | COc1cccc([C@H]2CC(O)CC3CN(c4ccc(Cl)c(OC)c4)CCN32)c1 |
| InChI | InChI=1S/C22H27ClN2O3/c1-27-19-5-3-4-15(10-19)21-13-18(26)11-17-14-24(8-9-25(17)21)16-6-7-20(23)22(12-16)28-2/h3-7,10,12,17-18,21,26H,8-9,11,13-14H2,1-2H3/t17?,18?,21-/m1/s1 |
| InChIKey | AYOISXJQBLDADR-WIXQSORDSA-N |
| XLogP | 3.74 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |