C17H21NO4 — CID 15839373
(4S,9aS)-4-(3,4-dimethoxyphenyl)-3,4,7,8,9,9a-hexahydro-1H-quinolizine-2,6-dione (PubChem CID 15839373) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (4S,9aS)-4-(3,4-dimethoxyphenyl)-3,4,7,8,9,9a-hexahydro-1H-quinolizine-2,6-dione.
| Compound Name | (4S,9aS)-4-(3,4-dimethoxyphenyl)-3,4,7,8,9,9a-hexahydro-1H-quinolizine-2,6-dione |
|---|---|
| PubChem CID | 15839373 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (4S,9aS)-4-(3,4-dimethoxyphenyl)-3,4,7,8,9,9a-hexahydro-1H-quinolizine-2,6-dione |
| SMILES | COc1ccc([C@@H]2CC(=O)C[C@@H]3CCCC(=O)N32)cc1OC |
| InChI | InChI=1S/C17H21NO4/c1-21-15-7-6-11(8-16(15)22-2)14-10-13(19)9-12-4-3-5-17(20)18(12)14/h6-8,12,14H,3-5,9-10H2,1-2H3/t12-,14-/m0/s1 |
| InChIKey | METMXDMHQRWSIO-JSGCOSHPSA-N |
| XLogP | 2.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |