C17H21NO3 — CID 69070572
methyl 4-[(4R,9aS)-6-oxo-1,2,3,4,7,8,9,9a-octahydroquinolizin-4-yl]benzoate (PubChem CID 69070572) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 4-[(4R,9aS)-6-oxo-1,2,3,4,7,8,9,9a-octahydroquinolizin-4-yl]benzoate.
| Compound Name | methyl 4-[(4R,9aS)-6-oxo-1,2,3,4,7,8,9,9a-octahydroquinolizin-4-yl]benzoate |
|---|---|
| PubChem CID | 69070572 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl 4-[(4R,9aS)-6-oxo-1,2,3,4,7,8,9,9a-octahydroquinolizin-4-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2CCC[C@H]3CCCC(=O)N32)cc1 |
| InChI | InChI=1S/C17H21NO3/c1-21-17(20)13-10-8-12(9-11-13)15-6-2-4-14-5-3-7-16(19)18(14)15/h8-11,14-15H,2-7H2,1H3/t14-,15+/m0/s1 |
| InChIKey | PSFKZPOQQYNWDV-LSDHHAIUSA-N |
| XLogP | 3.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |