C16H18N4O3 — CID 110455818
methyl 4-(2-acetamido-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate (PubChem CID 110455818) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is methyl 4-(2-acetamido-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate.
| Compound Name | methyl 4-(2-acetamido-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate |
|---|---|
| PubChem CID | 110455818 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | methyl 4-(2-acetamido-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2CCCc3nc(NC(C)=O)nn32)cc1 |
| InChI | InChI=1S/C16H18N4O3/c1-10(21)17-16-18-14-5-3-4-13(20(14)19-16)11-6-8-12(9-7-11)15(22)23-2/h6-9,13H,3-5H2,1-2H3,(H,17,19,21) |
| InChIKey | YZINKRUPGMZXEA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |