C18H22N2O2 — CID 132941861
methyl 4-[2-(3,4,5-trimethylpyrazol-1-yl)cyclobutyl]benzoate (PubChem CID 132941861) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is methyl 4-[2-(3,4,5-trimethylpyrazol-1-yl)cyclobutyl]benzoate.
| Compound Name | methyl 4-[2-(3,4,5-trimethylpyrazol-1-yl)cyclobutyl]benzoate |
|---|---|
| PubChem CID | 132941861 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | methyl 4-[2-(3,4,5-trimethylpyrazol-1-yl)cyclobutyl]benzoate |
| SMILES | COC(=O)c1ccc(C2CCC2n2nc(C)c(C)c2C)cc1 |
| InChI | InChI=1S/C18H22N2O2/c1-11-12(2)19-20(13(11)3)17-10-9-16(17)14-5-7-15(8-6-14)18(21)22-4/h5-8,16-17H,9-10H2,1-4H3 |
| InChIKey | VTIBHDOVOVVCNS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |