C15H18O4 — CID 102064566
methyl 4-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-2-yl]benzoate (PubChem CID 102064566) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl 4-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-2-yl]benzoate.
| Compound Name | methyl 4-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-2-yl]benzoate |
|---|---|
| PubChem CID | 102064566 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl 4-[(3aR,7aR)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2O[C@@H]3CCCC[C@H]3O2)cc1 |
| InChI | InChI=1S/C15H18O4/c1-17-14(16)10-6-8-11(9-7-10)15-18-12-4-2-3-5-13(12)19-15/h6-9,12-13,15H,2-5H2,1H3/t12-,13-/m1/s1 |
| InChIKey | FQYOAENUWQUUGD-CHWSQXEVSA-N |
| XLogP | 2.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |