About cyclohexylmethanediol;4-methoxycarbonylbenzoic acid
cyclohexylmethanediol;4-methoxycarbonylbenzoic acid (PubChem CID 175571680) has the molecular formula C16H22O6
and a molecular weight of 310.35 g/mol. Its IUPAC name is cyclohexylmethanediol;4-methoxycarbonylbenzoic acid.
Molecular Properties
| Compound Name | cyclohexylmethanediol;4-methoxycarbonylbenzoic acid |
| PubChem CID | 175571680 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | cyclohexylmethanediol;4-methoxycarbonylbenzoic acid |
| SMILES | COC(=O)c1ccc(C(=O)O)cc1.OC(O)C1CCCCC1 |
| InChI | InChI=1S/C9H8O4.C7H14O2/c1-13-9(12)7-4-2-6(3-5-7)8(10)11;8-7(9)6-4-2-1-3-5-6/h2-5H,1H3,(H,10,11);6-9H,1-5H2 |
| InChIKey | YUVLKTBCBREMNF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclohexylmethanediol;4-methoxycarbonylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexylmethanediol;4-methoxycarbonylbenzoic acid?
The IUPAC name of cyclohexylmethanediol;4-methoxycarbonylbenzoic acid (CID 175571680) is cyclohexylmethanediol;4-methoxycarbonylbenzoic acid.
What is the SMILES notation for cyclohexylmethanediol;4-methoxycarbonylbenzoic acid?
The canonical SMILES for cyclohexylmethanediol;4-methoxycarbonylbenzoic acid is COC(=O)c1ccc(C(=O)O)cc1.OC(O)C1CCCCC1.
What is the InChIKey of cyclohexylmethanediol;4-methoxycarbonylbenzoic acid?
The InChIKey is YUVLKTBCBREMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.C7H14O2/c1-13-9(12)7-4-2-6(3-5-7)8(10)11;8-7(9)6-4-2-1-3-5-6/h2-5H,1H3,(H,10,11);6-9H,1-5H2.
What are the key properties of cyclohexylmethanediol;4-methoxycarbonylbenzoic acid?
cyclohexylmethanediol;4-methoxycarbonylbenzoic acid has a molecular weight of 310.35 g/mol, XLogP of 2.05, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexylmethanediol;4-methoxycarbonylbenzoic acid is sourced from PubChem (CID 175571680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).