C27H26O5 — CID 42604041
methyl 4-[(2R,6S)-6-(4-methoxycarbonylphenyl)-4-phenyloxan-2-yl]benzoate (PubChem CID 42604041) has the molecular formula C27H26O5 and a molecular weight of 430.50 g/mol. Its IUPAC name is methyl 4-[(2R,6S)-6-(4-methoxycarbonylphenyl)-4-phenyloxan-2-yl]benzoate.
| Compound Name | methyl 4-[(2R,6S)-6-(4-methoxycarbonylphenyl)-4-phenyloxan-2-yl]benzoate |
|---|---|
| PubChem CID | 42604041 |
| Molecular Formula | C27H26O5 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | methyl 4-[(2R,6S)-6-(4-methoxycarbonylphenyl)-4-phenyloxan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@@H]2CC(c3ccccc3)C[C@H](c3ccc(C(=O)OC)cc3)O2)cc1 |
| InChI | InChI=1S/C27H26O5/c1-30-26(28)21-12-8-19(9-13-21)24-16-23(18-6-4-3-5-7-18)17-25(32-24)20-10-14-22(15-11-20)27(29)31-2/h3-15,23-25H,16-17H2,1-2H3/t23?,24-,25+ |
| InChIKey | RGXWOZIQZFEZGI-QILAJZQNSA-N |
| XLogP | 5.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |