C13H14N2O5 — CID 711596
methyl 4-[(2S,3S)-3-nitro-6-oxopiperidin-2-yl]benzoate (PubChem CID 711596) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is methyl 4-[(2S,3S)-3-nitro-6-oxopiperidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S,3S)-3-nitro-6-oxopiperidin-2-yl]benzoate |
|---|---|
| PubChem CID | 711596 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | methyl 4-[(2S,3S)-3-nitro-6-oxopiperidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2NC(=O)CC[C@@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H14N2O5/c1-20-13(17)9-4-2-8(3-5-9)12-10(15(18)19)6-7-11(16)14-12/h2-5,10,12H,6-7H2,1H3,(H,14,16)/t10-,12?/m0/s1 |
| InChIKey | UVXBSXLPWBAFPP-NUHJPDEHSA-N |
| XLogP | 1.07 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|