C19H22N2O3S2 — CID 17038567
methyl 4-[(7aR)-6-cyclohexyl-7-oxo-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-3-yl]benzoate (PubChem CID 17038567) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is methyl 4-[(7aR)-6-cyclohexyl-7-oxo-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-3-yl]benzoate.
| Compound Name | methyl 4-[(7aR)-6-cyclohexyl-7-oxo-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-3-yl]benzoate |
|---|---|
| PubChem CID | 17038567 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | methyl 4-[(7aR)-6-cyclohexyl-7-oxo-5-sulfanylidene-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2SC[C@H]3C(=O)N(C4CCCCC4)C(=S)N23)cc1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-24-18(23)13-9-7-12(8-10-13)17-21-15(11-26-17)16(22)20(19(21)25)14-5-3-2-4-6-14/h7-10,14-15,17H,2-6,11H2,1H3/t15-,17?/m0/s1 |
| InChIKey | CPWMGKMZPRAEEY-MYJWUSKBSA-N |
| XLogP | 3.35 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|