C17H21NO5 — CID 102029199
methyl (6S,11bR)-9,10-dimethoxy-4-oxo-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizine-6-carboxylate (PubChem CID 102029199) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl (6S,11bR)-9,10-dimethoxy-4-oxo-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizine-6-carboxylate.
| Compound Name | methyl (6S,11bR)-9,10-dimethoxy-4-oxo-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizine-6-carboxylate |
|---|---|
| PubChem CID | 102029199 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl (6S,11bR)-9,10-dimethoxy-4-oxo-1,2,3,6,7,11b-hexahydrobenzo[a]quinolizine-6-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2cc(OC)c(OC)cc2[C@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C17H21NO5/c1-21-14-8-10-7-13(17(20)23-3)18-12(5-4-6-16(18)19)11(10)9-15(14)22-2/h8-9,12-13H,4-7H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | QAAXXDCIZQJXIR-OLZOCXBDSA-N |
| XLogP | 1.86 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |