C17H22N2O3 — CID 10990303
(1S,11R)-4,5-dimethoxy-10,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-16-one (PubChem CID 10990303) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1S,11R)-4,5-dimethoxy-10,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-16-one.
| Compound Name | (1S,11R)-4,5-dimethoxy-10,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-16-one |
|---|---|
| PubChem CID | 10990303 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (1S,11R)-4,5-dimethoxy-10,15-diazatetracyclo[8.7.0.02,7.011,15]heptadeca-2,4,6-trien-16-one |
| SMILES | COc1cc2c(cc1OC)[C@@H]1CC(=O)N3CCC[C@@H]3N1CC2 |
| InChI | InChI=1S/C17H22N2O3/c1-21-14-8-11-5-7-18-13(12(11)9-15(14)22-2)10-17(20)19-6-3-4-16(18)19/h8-9,13,16H,3-7,10H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | RJKLJBXTFIACDJ-XJKSGUPXSA-N |
| XLogP | 1.96 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |