C21H27NO3 — CID 3703210
9,10-dimethoxy-3,3-dimethyl-4,6,7,11b,12,13-hexahydro-2H-isoquinolino[2,1-a]quinolin-1-one (PubChem CID 3703210) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 9,10-dimethoxy-3,3-dimethyl-4,6,7,11b,12,13-hexahydro-2H-isoquinolino[2,1-a]quinolin-1-one.
| Compound Name | 9,10-dimethoxy-3,3-dimethyl-4,6,7,11b,12,13-hexahydro-2H-isoquinolino[2,1-a]quinolin-1-one |
|---|---|
| PubChem CID | 3703210 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 9,10-dimethoxy-3,3-dimethyl-4,6,7,11b,12,13-hexahydro-2H-isoquinolino[2,1-a]quinolin-1-one |
| SMILES | COc1cc2c(cc1OC)C1CCC3=C(CC(C)(C)CC3=O)N1CC2 |
| InChI | InChI=1S/C21H27NO3/c1-21(2)11-17-14(18(23)12-21)5-6-16-15-10-20(25-4)19(24-3)9-13(15)7-8-22(16)17/h9-10,16H,5-8,11-12H2,1-4H3 |
| InChIKey | ZYBOHQVDOFAGMO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |