C20H23NO4S — CID 15895736
13,14-dimethoxy-4,4-dimethyl-5-thia-1-azatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),11,13,15-tetraene-6,8-dione (PubChem CID 15895736) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 13,14-dimethoxy-4,4-dimethyl-5-thia-1-azatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),11,13,15-tetraene-6,8-dione.
| Compound Name | 13,14-dimethoxy-4,4-dimethyl-5-thia-1-azatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),11,13,15-tetraene-6,8-dione |
|---|---|
| PubChem CID | 15895736 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 13,14-dimethoxy-4,4-dimethyl-5-thia-1-azatetracyclo[8.8.0.02,7.011,16]octadeca-2(7),11,13,15-tetraene-6,8-dione |
| SMILES | COc1cc2c(cc1OC)C1CC(=O)C3=C(CC(C)(C)SC3=O)N1CC2 |
| InChI | InChI=1S/C20H23NO4S/c1-20(2)10-14-18(19(23)26-20)15(22)9-13-12-8-17(25-4)16(24-3)7-11(12)5-6-21(13)14/h7-8,13H,5-6,9-10H2,1-4H3 |
| InChIKey | BOXWZSUSSSOYMR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|