C20H23NO3 — CID 95560155
(11bS)-9,10-dimethoxy-3-methyl-1,2,6,7,11b,12-hexahydroisoquinolino[2,1-a]quinolin-13-one (PubChem CID 95560155) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (11bS)-9,10-dimethoxy-3-methyl-1,2,6,7,11b,12-hexahydroisoquinolino[2,1-a]quinolin-13-one.
| Compound Name | (11bS)-9,10-dimethoxy-3-methyl-1,2,6,7,11b,12-hexahydroisoquinolino[2,1-a]quinolin-13-one |
|---|---|
| PubChem CID | 95560155 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (11bS)-9,10-dimethoxy-3-methyl-1,2,6,7,11b,12-hexahydroisoquinolino[2,1-a]quinolin-13-one |
| SMILES | COc1cc2c(cc1OC)[C@@H]1CC(=O)C3=C(C=C(C)CC3)N1CC2 |
| InChI | InChI=1S/C20H23NO3/c1-12-4-5-14-16(8-12)21-7-6-13-9-19(23-2)20(24-3)10-15(13)17(21)11-18(14)22/h8-10,17H,4-7,11H2,1-3H3/t17-/m0/s1 |
| InChIKey | SDRNAXVKUQBIAU-KRWDZBQOSA-N |
| XLogP | 3.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |