C22H28N4O4 — CID 162964799
[[(11bR)-9,10-dimethoxy-3,3-dimethyl-1-oxo-2,4,6,7,11b,12-hexahydroisoquinolino[2,1-a]quinolin-13-ylidene]amino]urea (PubChem CID 162964799) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is [[(11bR)-9,10-dimethoxy-3,3-dimethyl-1-oxo-2,4,6,7,11b,12-hexahydroisoquinolino[2,1-a]quinolin-13-ylidene]amino]urea.
| Compound Name | [[(11bR)-9,10-dimethoxy-3,3-dimethyl-1-oxo-2,4,6,7,11b,12-hexahydroisoquinolino[2,1-a]quinolin-13-ylidene]amino]urea |
|---|---|
| PubChem CID | 162964799 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [[(11bR)-9,10-dimethoxy-3,3-dimethyl-1-oxo-2,4,6,7,11b,12-hexahydroisoquinolino[2,1-a]quinolin-13-ylidene]amino]urea |
| SMILES | COc1cc2c(cc1OC)[C@H]1CC(=NNC(N)=O)C3=C(CC(C)(C)CC3=O)N1CC2 |
| InChI | InChI=1S/C22H28N4O4/c1-22(2)10-16-20(17(27)11-22)14(24-25-21(23)28)9-15-13-8-19(30-4)18(29-3)7-12(13)5-6-26(15)16/h7-8,15H,5-6,9-11H2,1-4H3,(H3,23,25,28)/t15-/m1/s1 |
| InChIKey | SXHUCIYBPDRDFT-OAHLLOKOSA-N |
| XLogP | 2.67 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|