C12H16O3 — CID 101368184
(2R)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 101368184) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2R)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2R)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 101368184 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2R)-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc2c(cc1OC)C[C@H](O)CC2 |
| InChI | InChI=1S/C12H16O3/c1-14-11-6-8-3-4-10(13)5-9(8)7-12(11)15-2/h6-7,10,13H,3-5H2,1-2H3/t10-/m1/s1 |
| InChIKey | CJYZRUVSCMUKQT-SNVBAGLBSA-N |
| XLogP | 1.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |