C25H29NO3 — CID 141025412
1-[(1R,2R)-2-(3,4-dimethoxyphenyl)cyclohexyl]-4-phenoxy-2H-pyridine (PubChem CID 141025412) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-[(1R,2R)-2-(3,4-dimethoxyphenyl)cyclohexyl]-4-phenoxy-2H-pyridine.
| Compound Name | 1-[(1R,2R)-2-(3,4-dimethoxyphenyl)cyclohexyl]-4-phenoxy-2H-pyridine |
|---|---|
| PubChem CID | 141025412 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-[(1R,2R)-2-(3,4-dimethoxyphenyl)cyclohexyl]-4-phenoxy-2H-pyridine |
| SMILES | COc1ccc([C@H]2CCCC[C@H]2N2C=CC(Oc3ccccc3)=CC2)cc1OC |
| InChI | InChI=1S/C25H29NO3/c1-27-24-13-12-19(18-25(24)28-2)22-10-6-7-11-23(22)26-16-14-21(15-17-26)29-20-8-4-3-5-9-20/h3-5,8-9,12-16,18,22-23H,6-7,10-11,17H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | ZOZYGPKTBGNPFG-DHIUTWEWSA-N |
| XLogP | 5.52 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |