C23H23NO2 — CID 171194795
(2S)-2-(3,4-diphenoxyphenyl)piperidine (PubChem CID 171194795) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2S)-2-(3,4-diphenoxyphenyl)piperidine.
| Compound Name | (2S)-2-(3,4-diphenoxyphenyl)piperidine |
|---|---|
| PubChem CID | 171194795 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2S)-2-(3,4-diphenoxyphenyl)piperidine |
| SMILES | c1ccc(Oc2ccc([C@@H]3CCCCN3)cc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO2/c1-3-9-19(10-4-1)25-22-15-14-18(21-13-7-8-16-24-21)17-23(22)26-20-11-5-2-6-12-20/h1-6,9-12,14-15,17,21,24H,7-8,13,16H2/t21-/m0/s1 |
| InChIKey | FAZFFJQEVKNCDL-NRFANRHFSA-N |
| XLogP | 6.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |