C19H23NO3 — CID 139798871
(3R,4R)-3-(3,4-dimethoxyphenyl)-4-(3-methoxyphenyl)pyrrolidine (PubChem CID 139798871) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (3R,4R)-3-(3,4-dimethoxyphenyl)-4-(3-methoxyphenyl)pyrrolidine.
| Compound Name | (3R,4R)-3-(3,4-dimethoxyphenyl)-4-(3-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 139798871 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (3R,4R)-3-(3,4-dimethoxyphenyl)-4-(3-methoxyphenyl)pyrrolidine |
| SMILES | COc1cccc([C@@H]2CNC[C@H]2c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C19H23NO3/c1-21-15-6-4-5-13(9-15)16-11-20-12-17(16)14-7-8-18(22-2)19(10-14)23-3/h4-10,16-17,20H,11-12H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | GHAQMMYWBCALOD-IRXDYDNUSA-N |
| XLogP | 3.18 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |