C35H37N3O5 — CID 52946680
N-[2,4,6,8-tetrakis(4-methoxyphenyl)-3,7-diazabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine (PubChem CID 52946680) has the molecular formula C35H37N3O5 and a molecular weight of 579.70 g/mol. Its IUPAC name is N-[2,4,6,8-tetrakis(4-methoxyphenyl)-3,7-diazabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine.
| Compound Name | N-[2,4,6,8-tetrakis(4-methoxyphenyl)-3,7-diazabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 52946680 |
| Molecular Formula | C35H37N3O5 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | N-[2,4,6,8-tetrakis(4-methoxyphenyl)-3,7-diazabicyclo[3.3.1]nonan-9-ylidene]hydroxylamine |
| SMILES | COc1ccc(C2NC(c3ccc(OC)cc3)C3C(=NO)C2C(c2ccc(OC)cc2)NC3c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H37N3O5/c1-40-25-13-5-21(6-14-25)31-29-32(22-7-15-26(41-2)16-8-22)37-34(24-11-19-28(43-4)20-12-24)30(35(29)38-39)33(36-31)23-9-17-27(42-3)18-10-23/h5-20,29-34,36-37,39H,1-4H3 |
| InChIKey | MWWRGAJROBEGGV-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|