C23H28N2O3 — CID 71590549
N-methoxy-2,4-bis(4-methoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-imine (PubChem CID 71590549) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-methoxy-2,4-bis(4-methoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-imine.
| Compound Name | N-methoxy-2,4-bis(4-methoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-imine |
|---|---|
| PubChem CID | 71590549 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-methoxy-2,4-bis(4-methoxyphenyl)-3-azabicyclo[3.3.1]nonan-9-imine |
| SMILES | CON=C1C2CCCC1C(c1ccc(OC)cc1)NC2c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-26-17-11-7-15(8-12-17)21-19-5-4-6-20(23(19)25-28-3)22(24-21)16-9-13-18(27-2)14-10-16/h7-14,19-22,24H,4-6H2,1-3H3 |
| InChIKey | WOLDNMUMRBLILQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|