C21H25N3O6 — CID 2870060
2,6-bis(4-methoxyphenyl)-4,4-dimethyl-3,5-dinitropiperidine (PubChem CID 2870060) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2,6-bis(4-methoxyphenyl)-4,4-dimethyl-3,5-dinitropiperidine.
| Compound Name | 2,6-bis(4-methoxyphenyl)-4,4-dimethyl-3,5-dinitropiperidine |
|---|---|
| PubChem CID | 2870060 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 2,6-bis(4-methoxyphenyl)-4,4-dimethyl-3,5-dinitropiperidine |
| SMILES | COc1ccc(C2NC(c3ccc(OC)cc3)C([N+](=O)[O-])C(C)(C)C2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H25N3O6/c1-21(2)19(23(25)26)17(13-5-9-15(29-3)10-6-13)22-18(20(21)24(27)28)14-7-11-16(30-4)12-8-14/h5-12,17-20,22H,1-4H3 |
| InChIKey | PHVJOZFYTCDHBH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|