C17H16N2O4 — CID 122378979
(2R,3R)-2-(4-methoxyphenyl)-8-methyl-3-nitro-2,3-dihydro-1H-quinolin-4-one (PubChem CID 122378979) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is (2R,3R)-2-(4-methoxyphenyl)-8-methyl-3-nitro-2,3-dihydro-1H-quinolin-4-one.
| Compound Name | (2R,3R)-2-(4-methoxyphenyl)-8-methyl-3-nitro-2,3-dihydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 122378979 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (2R,3R)-2-(4-methoxyphenyl)-8-methyl-3-nitro-2,3-dihydro-1H-quinolin-4-one |
| SMILES | COc1ccc([C@H]2Nc3c(C)cccc3C(=O)[C@@H]2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N2O4/c1-10-4-3-5-13-14(10)18-15(16(17(13)20)19(21)22)11-6-8-12(23-2)9-7-11/h3-9,15-16,18H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | ZQUNIOGYVGZIHK-HZPDHXFCSA-N |
| XLogP | 3.00 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|