C10H10ClNO2 — CID 11171849
(3S,4S)-3-chloro-4-(4-methoxyphenyl)azetidin-2-one (PubChem CID 11171849) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is (3S,4S)-3-chloro-4-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4S)-3-chloro-4-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 11171849 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (3S,4S)-3-chloro-4-(4-methoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc([C@@H]2NC(=O)[C@H]2Cl)cc1 |
| InChI | InChI=1S/C10H10ClNO2/c1-14-7-4-2-6(3-5-7)9-8(11)10(13)12-9/h2-5,8-9H,1H3,(H,12,13)/t8-,9-/m0/s1 |
| InChIKey | RAAPKDNESKFCMB-IUCAKERBSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|