C26H34N6O4 — CID 177442101
(1E,7E)-5,12-bis(4-methoxyphenyl)-6,7,13,14-tetramethyl-1,2,4,8,9,11-hexazacyclotetradeca-7,14-diene-3,10-dione (PubChem CID 177442101) has the molecular formula C26H34N6O4 and a molecular weight of 494.60 g/mol. Its IUPAC name is (1E,7E)-5,12-bis(4-methoxyphenyl)-6,7,13,14-tetramethyl-1,2,4,8,9,11-hexazacyclotetradeca-7,14-diene-3,10-dione.
| Compound Name | (1E,7E)-5,12-bis(4-methoxyphenyl)-6,7,13,14-tetramethyl-1,2,4,8,9,11-hexazacyclotetradeca-7,14-diene-3,10-dione |
|---|---|
| PubChem CID | 177442101 |
| Molecular Formula | C26H34N6O4 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (1E,7E)-5,12-bis(4-methoxyphenyl)-6,7,13,14-tetramethyl-1,2,4,8,9,11-hexazacyclotetradeca-7,14-diene-3,10-dione |
| SMILES | COc1ccc(C2NC(=O)N/N=C(/C)C(C)C(c3ccc(OC)cc3)NC(=O)N/N=C(/C)C2C)cc1 |
| InChI | InChI=1S/C26H34N6O4/c1-15-17(3)29-31-26(34)28-24(20-9-13-22(36-6)14-10-20)16(2)18(4)30-32-25(33)27-23(15)19-7-11-21(35-5)12-8-19/h7-16,23-24H,1-6H3,(H2,27,32,33)(H2,28,31,34)/b29-17-,30-18- |
| InChIKey | LOBVINKKHOKZET-LZUTUTKMSA-N |
| XLogP | 4.12 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |