C9H12N4O2 — CID 24829281
6-(4-methoxyphenyl)-1,2,4,5-tetrazinan-3-one (PubChem CID 24829281) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-1,2,4,5-tetrazinan-3-one.
| Compound Name | 6-(4-methoxyphenyl)-1,2,4,5-tetrazinan-3-one |
|---|---|
| PubChem CID | 24829281 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 6-(4-methoxyphenyl)-1,2,4,5-tetrazinan-3-one |
| SMILES | COc1ccc(C2NNC(=O)NN2)cc1 |
| InChI | InChI=1S/C9H12N4O2/c1-15-7-4-2-6(3-5-7)8-10-12-9(14)13-11-8/h2-5,8,10-11H,1H3,(H2,12,13,14) |
| InChIKey | OBYXRVRKMVGLTG-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |