C25H22Cl2N4O3 — CID 101438864
4,5-bis(4-chlorophenyl)-8a-(4-methoxyphenyl)-3,4,4a,5,6,8-hexahydro-1H-pyrimido[4,5-d]pyrimidine-2,7-dione (PubChem CID 101438864) has the molecular formula C25H22Cl2N4O3 and a molecular weight of 497.38 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-8a-(4-methoxyphenyl)-3,4,4a,5,6,8-hexahydro-1H-pyrimido[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 4,5-bis(4-chlorophenyl)-8a-(4-methoxyphenyl)-3,4,4a,5,6,8-hexahydro-1H-pyrimido[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 101438864 |
| Molecular Formula | C25H22Cl2N4O3 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-8a-(4-methoxyphenyl)-3,4,4a,5,6,8-hexahydro-1H-pyrimido[4,5-d]pyrimidine-2,7-dione |
| SMILES | COc1ccc(C23NC(=O)NC(c4ccc(Cl)cc4)C2C(c2ccc(Cl)cc2)NC(=O)N3)cc1 |
| InChI | InChI=1S/C25H22Cl2N4O3/c1-34-19-12-6-16(7-13-19)25-20(21(28-23(32)30-25)14-2-8-17(26)9-3-14)22(29-24(33)31-25)15-4-10-18(27)11-5-15/h2-13,20-22H,1H3,(H2,28,30,32)(H2,29,31,33) |
| InChIKey | MPYQLHWWZJHJLU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |