C11H11N3O2S — CID 136900618
(3R,3aR)-3-(4-methoxyphenyl)-2,3,3a,6-tetrahydropyrazolo[3,4-d][1,3]thiazol-5-one (PubChem CID 136900618) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is (3R,3aR)-3-(4-methoxyphenyl)-2,3,3a,6-tetrahydropyrazolo[3,4-d][1,3]thiazol-5-one.
| Compound Name | (3R,3aR)-3-(4-methoxyphenyl)-2,3,3a,6-tetrahydropyrazolo[3,4-d][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 136900618 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (3R,3aR)-3-(4-methoxyphenyl)-2,3,3a,6-tetrahydropyrazolo[3,4-d][1,3]thiazol-5-one |
| SMILES | COc1ccc([C@H]2NN=C3NC(=O)S[C@@H]32)cc1 |
| InChI | InChI=1S/C11H11N3O2S/c1-16-7-4-2-6(3-5-7)8-9-10(14-13-8)12-11(15)17-9/h2-5,8-9,13H,1H3,(H,12,14,15)/t8-,9-/m1/s1 |
| InChIKey | NQVPTRDENBMXIQ-RKDXNWHRSA-N |
| XLogP | 1.48 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|