C21H26NO3+ — CID 7064593
(2R,3R,5S,6S)-2,6-bis(4-methoxyphenyl)-3,5-dimethylpiperidin-1-ium-4-one (PubChem CID 7064593) has the molecular formula C21H26NO3+ and a molecular weight of 340.44 g/mol. Its IUPAC name is (2R,3R,5S,6S)-2,6-bis(4-methoxyphenyl)-3,5-dimethylpiperidin-1-ium-4-one.
| Compound Name | (2R,3R,5S,6S)-2,6-bis(4-methoxyphenyl)-3,5-dimethylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 7064593 |
| Molecular Formula | C21H26NO3+ |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (2R,3R,5S,6S)-2,6-bis(4-methoxyphenyl)-3,5-dimethylpiperidin-1-ium-4-one |
| SMILES | COc1ccc(C2[NH2+][C@@H](c3ccc(OC)cc3)[C@@H](C)C(=O)[C@H]2C)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-13-19(15-5-9-17(24-3)10-6-15)22-20(14(2)21(13)23)16-7-11-18(25-4)12-8-16/h5-14,19-20,22H,1-4H3/p+1/t13-,14+,19-,20?/m1/s1 |
| InChIKey | RVYZVGKIODSCSZ-IIYFMBBLSA-O |
| XLogP | 2.90 |
| TPSA | 52.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |