C19H19Br2N3O4 — CID 3132805
2,6-bis(4-bromophenyl)-4,4-dimethyl-3,5-dinitropiperidine (PubChem CID 3132805) has the molecular formula C19H19Br2N3O4 and a molecular weight of 513.19 g/mol. Its IUPAC name is 2,6-bis(4-bromophenyl)-4,4-dimethyl-3,5-dinitropiperidine.
| Compound Name | 2,6-bis(4-bromophenyl)-4,4-dimethyl-3,5-dinitropiperidine |
|---|---|
| PubChem CID | 3132805 |
| Molecular Formula | C19H19Br2N3O4 |
| Molecular Weight | 513.19 g/mol |
| Exact Mass | 510.97 |
| IUPAC Name | 2,6-bis(4-bromophenyl)-4,4-dimethyl-3,5-dinitropiperidine |
| SMILES | CC1(C)C([N+](=O)[O-])C(c2ccc(Br)cc2)NC(c2ccc(Br)cc2)C1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19Br2N3O4/c1-19(2)17(23(25)26)15(11-3-7-13(20)8-4-11)22-16(18(19)24(27)28)12-5-9-14(21)10-6-12/h3-10,15-18,22H,1-2H3 |
| InChIKey | HUTRAJQDESQABB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|